C6H10N2S — CID 143608673
2,3-dimethyl-4,5-dihydropyrimidine-6-thione (PubChem CID 143608673) has the molecular formula C6H10N2S and a molecular weight of 142.23 g/mol. Its IUPAC name is 2,3-dimethyl-4,5-dihydropyrimidine-6-thione.
| Compound Name | 2,3-dimethyl-4,5-dihydropyrimidine-6-thione |
|---|---|
| PubChem CID | 143608673 |
| Molecular Formula | C6H10N2S |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 2,3-dimethyl-4,5-dihydropyrimidine-6-thione |
| SMILES | CC1=NC(=S)CCN1C |
| InChI | InChI=1S/C6H10N2S/c1-5-7-6(9)3-4-8(5)2/h3-4H2,1-2H3 |
| InChIKey | BCXDORFOAPYUDW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|