About ethane;N-ethyl-N'-methyl-N-(3-sulfanylpropyl)ethanimidamide
ethane;N-ethyl-N'-methyl-N-(3-sulfanylpropyl)ethanimidamide (PubChem CID 170645840) has the molecular formula C10H24N2S
and a molecular weight of 204.38 g/mol. Its IUPAC name is ethane;N-ethyl-N'-methyl-N-(3-sulfanylpropyl)ethanimidamide.
Molecular Properties
| Compound Name | ethane;N-ethyl-N'-methyl-N-(3-sulfanylpropyl)ethanimidamide |
| PubChem CID | 170645840 |
| Molecular Formula | C10H24N2S |
| Molecular Weight | 204.38 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | ethane;N-ethyl-N'-methyl-N-(3-sulfanylpropyl)ethanimidamide |
| SMILES | CC.CCN(CCCS)/C(C)=N/C |
| InChI | InChI=1S/C8H18N2S.C2H6/c1-4-10(6-5-7-11)8(2)9-3;1-2/h11H,4-7H2,1-3H3;1-2H3/b9-8+; |
| InChIKey | GJALGQLGHRAAFN-HRNDJLQDSA-N |
| XLogP | 2.70 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-ethyl-N'-methyl-N-(3-sulfanylpropyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-N'-methyl-N-(3-sulfanylpropyl)ethanimidamide?
The IUPAC name of ethane;N-ethyl-N'-methyl-N-(3-sulfanylpropyl)ethanimidamide (CID 170645840) is ethane;N-ethyl-N'-methyl-N-(3-sulfanylpropyl)ethanimidamide.
What is the SMILES notation for ethane;N-ethyl-N'-methyl-N-(3-sulfanylpropyl)ethanimidamide?
The canonical SMILES for ethane;N-ethyl-N'-methyl-N-(3-sulfanylpropyl)ethanimidamide is CC.CCN(CCCS)/C(C)=N/C.
What is the InChIKey of ethane;N-ethyl-N'-methyl-N-(3-sulfanylpropyl)ethanimidamide?
The InChIKey is GJALGQLGHRAAFN-HRNDJLQDSA-N. The full InChI is InChI=1S/C8H18N2S.C2H6/c1-4-10(6-5-7-11)8(2)9-3;1-2/h11H,4-7H2,1-3H3;1-2H3/b9-8+;.
What are the key properties of ethane;N-ethyl-N'-methyl-N-(3-sulfanylpropyl)ethanimidamide?
ethane;N-ethyl-N'-methyl-N-(3-sulfanylpropyl)ethanimidamide has a molecular weight of 204.38 g/mol, XLogP of 2.70, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-N'-methyl-N-(3-sulfanylpropyl)ethanimidamide is sourced from PubChem (CID 170645840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).