About N-[amino-[methyl(propyl)amino]methylidene]-N'-methyl-2-sulfanylethanimidamide;ethane
N-[amino-[methyl(propyl)amino]methylidene]-N'-methyl-2-sulfanylethanimidamide;ethane (PubChem CID 144623062) has the molecular formula C10H24N4S
and a molecular weight of 232.40 g/mol. Its IUPAC name is N-[amino-[methyl(propyl)amino]methylidene]-N'-methyl-2-sulfanylethanimidamide;ethane.
Molecular Properties
| Compound Name | N-[amino-[methyl(propyl)amino]methylidene]-N'-methyl-2-sulfanylethanimidamide;ethane |
| PubChem CID | 144623062 |
| Molecular Formula | C10H24N4S |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | N-[amino-[methyl(propyl)amino]methylidene]-N'-methyl-2-sulfanylethanimidamide;ethane |
| SMILES | CC.CCCN(C)/C(N)=N/C(CS)=N/C |
| InChI | InChI=1S/C8H18N4S.C2H6/c1-4-5-12(3)8(9)11-7(6-13)10-2;1-2/h13H,4-6H2,1-3H3,(H2,9,10,11);1-2H3 |
| InChIKey | XVSBGXPOLTUPRB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[amino-[methyl(propyl)amino]methylidene]-N'-methyl-2-sulfanylethanimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[amino-[methyl(propyl)amino]methylidene]-N'-methyl-2-sulfanylethanimidamide;ethane?
The IUPAC name of N-[amino-[methyl(propyl)amino]methylidene]-N'-methyl-2-sulfanylethanimidamide;ethane (CID 144623062) is N-[amino-[methyl(propyl)amino]methylidene]-N'-methyl-2-sulfanylethanimidamide;ethane.
What is the SMILES notation for N-[amino-[methyl(propyl)amino]methylidene]-N'-methyl-2-sulfanylethanimidamide;ethane?
The canonical SMILES for N-[amino-[methyl(propyl)amino]methylidene]-N'-methyl-2-sulfanylethanimidamide;ethane is CC.CCCN(C)/C(N)=N/C(CS)=N/C.
What is the InChIKey of N-[amino-[methyl(propyl)amino]methylidene]-N'-methyl-2-sulfanylethanimidamide;ethane?
The InChIKey is XVSBGXPOLTUPRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4S.C2H6/c1-4-5-12(3)8(9)11-7(6-13)10-2;1-2/h13H,4-6H2,1-3H3,(H2,9,10,11);1-2H3.
What are the key properties of N-[amino-[methyl(propyl)amino]methylidene]-N'-methyl-2-sulfanylethanimidamide;ethane?
N-[amino-[methyl(propyl)amino]methylidene]-N'-methyl-2-sulfanylethanimidamide;ethane has a molecular weight of 232.40 g/mol, XLogP of 1.63, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[amino-[methyl(propyl)amino]methylidene]-N'-methyl-2-sulfanylethanimidamide;ethane is sourced from PubChem (CID 144623062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).