About N-ethylsulfanyl-N-methyl-N'-propylethanimidamide
N-ethylsulfanyl-N-methyl-N'-propylethanimidamide (PubChem CID 138571649) has the molecular formula C8H18N2S
and a molecular weight of 174.31 g/mol. Its IUPAC name is N-ethylsulfanyl-N-methyl-N'-propylethanimidamide.
Molecular Properties
| Compound Name | N-ethylsulfanyl-N-methyl-N'-propylethanimidamide |
| PubChem CID | 138571649 |
| Molecular Formula | C8H18N2S |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | N-ethylsulfanyl-N-methyl-N'-propylethanimidamide |
| SMILES | CCC/N=C(\C)N(C)SCC |
| InChI | InChI=1S/C8H18N2S/c1-5-7-9-8(3)10(4)11-6-2/h5-7H2,1-4H3/b9-8+ |
| InChIKey | IIKXPPKOVJYNBR-CMDGGOBGSA-N |
| XLogP | 2.41 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethylsulfanyl-N-methyl-N'-propylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylsulfanyl-N-methyl-N'-propylethanimidamide?
The IUPAC name of N-ethylsulfanyl-N-methyl-N'-propylethanimidamide (CID 138571649) is N-ethylsulfanyl-N-methyl-N'-propylethanimidamide.
What is the SMILES notation for N-ethylsulfanyl-N-methyl-N'-propylethanimidamide?
The canonical SMILES for N-ethylsulfanyl-N-methyl-N'-propylethanimidamide is CCC/N=C(\C)N(C)SCC.
What is the InChIKey of N-ethylsulfanyl-N-methyl-N'-propylethanimidamide?
The InChIKey is IIKXPPKOVJYNBR-CMDGGOBGSA-N. The full InChI is InChI=1S/C8H18N2S/c1-5-7-9-8(3)10(4)11-6-2/h5-7H2,1-4H3/b9-8+.
What are the key properties of N-ethylsulfanyl-N-methyl-N'-propylethanimidamide?
N-ethylsulfanyl-N-methyl-N'-propylethanimidamide has a molecular weight of 174.31 g/mol, XLogP of 2.41, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylsulfanyl-N-methyl-N'-propylethanimidamide is sourced from PubChem (CID 138571649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).