C22H25Cl2N5O2 — CID 123301688
[5-chloro-2-[3-[4-(4-chlorobenzoyl)piperazin-1-yl]pyrrolidin-1-yl]phenyl]urea (PubChem CID 123301688) has the molecular formula C22H25Cl2N5O2 and a molecular weight of 462.38 g/mol. Its IUPAC name is [5-chloro-2-[3-[4-(4-chlorobenzoyl)piperazin-1-yl]pyrrolidin-1-yl]phenyl]urea.
| Compound Name | [5-chloro-2-[3-[4-(4-chlorobenzoyl)piperazin-1-yl]pyrrolidin-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 123301688 |
| Molecular Formula | C22H25Cl2N5O2 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | [5-chloro-2-[3-[4-(4-chlorobenzoyl)piperazin-1-yl]pyrrolidin-1-yl]phenyl]urea |
| SMILES | NC(=O)Nc1cc(Cl)ccc1N1CCC(N2CCN(C(=O)c3ccc(Cl)cc3)CC2)C1 |
| InChI | InChI=1S/C22H25Cl2N5O2/c23-16-3-1-15(2-4-16)21(30)28-11-9-27(10-12-28)18-7-8-29(14-18)20-6-5-17(24)13-19(20)26-22(25)31/h1-6,13,18H,7-12,14H2,(H3,25,26,31) |
| InChIKey | JARJATHUMNSGBK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |