C12H12FNO3S — CID 123303145
N-buta-1,3-dien-2-yl-N-(4-fluorophenyl)sulfonylacetamide (PubChem CID 123303145) has the molecular formula C12H12FNO3S and a molecular weight of 269.30 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-N-(4-fluorophenyl)sulfonylacetamide.
| Compound Name | N-buta-1,3-dien-2-yl-N-(4-fluorophenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 123303145 |
| Molecular Formula | C12H12FNO3S |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | N-buta-1,3-dien-2-yl-N-(4-fluorophenyl)sulfonylacetamide |
| SMILES | C=CC(=C)N(C(C)=O)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H12FNO3S/c1-4-9(2)14(10(3)15)18(16,17)12-7-5-11(13)6-8-12/h4-8H,1-2H2,3H3 |
| InChIKey | DIJKHIFNCWFPOA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|