C25H27N7O3 — CID 123303567
2-[4-(3-cyano-4-morpholin-4-yl-4-oxobut-2-enyl)anilino]-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 123303567) has the molecular formula C25H27N7O3 and a molecular weight of 473.54 g/mol. Its IUPAC name is 2-[4-(3-cyano-4-morpholin-4-yl-4-oxobut-2-enyl)anilino]-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-[4-(3-cyano-4-morpholin-4-yl-4-oxobut-2-enyl)anilino]-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 123303567 |
| Molecular Formula | C25H27N7O3 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 2-[4-(3-cyano-4-morpholin-4-yl-4-oxobut-2-enyl)anilino]-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)NC(=O)c1c[nH]c2ncc(Nc3ccc(CC=C(C#N)C(=O)N4CCOCC4)cc3)nc12 |
| InChI | InChI=1S/C25H27N7O3/c1-16(2)29-24(33)20-14-27-23-22(20)31-21(15-28-23)30-19-7-4-17(5-8-19)3-6-18(13-26)25(34)32-9-11-35-12-10-32/h4-8,14-16H,3,9-12H2,1-2H3,(H,27,28)(H,29,33)(H,30,31) |
| InChIKey | WXHUGLKIKVQVGS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|