About 7-methyl-7-azatricyclo[3.3.1.03,9]nonan-3-amine
7-methyl-7-azatricyclo[3.3.1.03,9]nonan-3-amine (PubChem CID 123304535) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 7-methyl-7-azatricyclo[3.3.1.03,9]nonan-3-amine.
Molecular Properties
| Compound Name | 7-methyl-7-azatricyclo[3.3.1.03,9]nonan-3-amine |
| PubChem CID | 123304535 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 7-methyl-7-azatricyclo[3.3.1.03,9]nonan-3-amine |
| SMILES | CN1CC2CC3(N)CC(C1)C23 |
| InChI | InChI=1S/C9H16N2/c1-11-4-6-2-9(10)3-7(5-11)8(6)9/h6-8H,2-5,10H2,1H3 |
| InChIKey | GSULILSDEHDHAY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-7-azatricyclo[3.3.1.03,9]nonan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-7-azatricyclo[3.3.1.03,9]nonan-3-amine?
The IUPAC name of 7-methyl-7-azatricyclo[3.3.1.03,9]nonan-3-amine (CID 123304535) is 7-methyl-7-azatricyclo[3.3.1.03,9]nonan-3-amine.
What is the SMILES notation for 7-methyl-7-azatricyclo[3.3.1.03,9]nonan-3-amine?
The canonical SMILES for 7-methyl-7-azatricyclo[3.3.1.03,9]nonan-3-amine is CN1CC2CC3(N)CC(C1)C23.
What is the InChIKey of 7-methyl-7-azatricyclo[3.3.1.03,9]nonan-3-amine?
The InChIKey is GSULILSDEHDHAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-11-4-6-2-9(10)3-7(5-11)8(6)9/h6-8H,2-5,10H2,1H3.
What are the key properties of 7-methyl-7-azatricyclo[3.3.1.03,9]nonan-3-amine?
7-methyl-7-azatricyclo[3.3.1.03,9]nonan-3-amine has a molecular weight of 152.24 g/mol, XLogP of 0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-7-azatricyclo[3.3.1.03,9]nonan-3-amine is sourced from PubChem (CID 123304535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).