C18H20N8O — CID 123305419
N-(1-imidazo[1,2-a]pyrazin-8-ylpyrrolidin-3-yl)-1-penta-1,3-dien-3-yl-1,2,4-triazole-3-carboxamide (PubChem CID 123305419) has the molecular formula C18H20N8O and a molecular weight of 364.41 g/mol. Its IUPAC name is N-(1-imidazo[1,2-a]pyrazin-8-ylpyrrolidin-3-yl)-1-penta-1,3-dien-3-yl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(1-imidazo[1,2-a]pyrazin-8-ylpyrrolidin-3-yl)-1-penta-1,3-dien-3-yl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 123305419 |
| Molecular Formula | C18H20N8O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-(1-imidazo[1,2-a]pyrazin-8-ylpyrrolidin-3-yl)-1-penta-1,3-dien-3-yl-1,2,4-triazole-3-carboxamide |
| SMILES | C=CC(=CC)n1cnc(C(=O)NC2CCN(c3nccn4ccnc34)C2)n1 |
| InChI | InChI=1S/C18H20N8O/c1-3-14(4-2)26-12-21-15(23-26)18(27)22-13-5-8-25(11-13)17-16-19-6-9-24(16)10-7-20-17/h3-4,6-7,9-10,12-13H,1,5,8,11H2,2H3,(H,22,27) |
| InChIKey | FNPZVRPUIHYZHA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|