C16H17N9O — CID 123514712
1-buta-1,3-dien-2-yl-N-[1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyrrolidin-3-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 123514712) has the molecular formula C16H17N9O and a molecular weight of 351.37 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yl-N-[1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyrrolidin-3-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-buta-1,3-dien-2-yl-N-[1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyrrolidin-3-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 123514712 |
| Molecular Formula | C16H17N9O |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-buta-1,3-dien-2-yl-N-[1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyrrolidin-3-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | C=CC(=C)n1cnc(C(=O)NC2CCN(c3nccn4cnnc34)C2)n1 |
| InChI | InChI=1S/C16H17N9O/c1-3-11(2)25-9-18-13(22-25)16(26)20-12-4-6-23(8-12)14-15-21-19-10-24(15)7-5-17-14/h3,5,7,9-10,12H,1-2,4,6,8H2,(H,20,26) |
| InChIKey | IYMRRKPTEOPNAO-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 106.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|