C35H53NO7 — CID 123305805
4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-[(3S,10R,13R,17R)-17-[(5S)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanedioate (PubChem CID 123305805) has the molecular formula C35H53NO7 and a molecular weight of 599.81 g/mol. Its IUPAC name is 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-[(3S,10R,13R,17R)-17-[(5S)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanedioate.
| Compound Name | 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-[(3S,10R,13R,17R)-17-[(5S)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanedioate |
|---|---|
| PubChem CID | 123305805 |
| Molecular Formula | C35H53NO7 |
| Molecular Weight | 599.81 g/mol |
| Exact Mass | 599.38 |
| IUPAC Name | 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-[(3S,10R,13R,17R)-17-[(5S)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanedioate |
| SMILES | CC(CC[C@H](O)C(C)C)[C@H]1CCC2C3CC=C4C[C@@H](OC(=O)CCC(=O)On5c(O)ccc5O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C35H53NO7/c1-21(2)29(37)11-6-22(3)26-9-10-27-25-8-7-23-20-24(16-18-34(23,4)28(25)17-19-35(26,27)5)42-32(40)14-15-33(41)43-36-30(38)12-13-31(36)39/h7,12-13,21-22,24-29,37-39H,6,8-11,14-20H2,1-5H3/t22?,24-,25?,26+,27?,28?,29-,34-,35+/m0/s1 |
| InChIKey | RIPDJSLHGYTBLJ-VFOCEXPSSA-N |
| XLogP | 6.56 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.81 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|