C31H29FN2O — CID 123306815
(2R,7S)-4-benzylidene-2-ethyl-14-(4-fluorophenyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-one (PubChem CID 123306815) has the molecular formula C31H29FN2O and a molecular weight of 464.58 g/mol. Its IUPAC name is (2R,7S)-4-benzylidene-2-ethyl-14-(4-fluorophenyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-one.
| Compound Name | (2R,7S)-4-benzylidene-2-ethyl-14-(4-fluorophenyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-one |
|---|---|
| PubChem CID | 123306815 |
| Molecular Formula | C31H29FN2O |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | (2R,7S)-4-benzylidene-2-ethyl-14-(4-fluorophenyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),12,15,17-tetraen-5-one |
| SMILES | CC[C@@]12CC(=Cc3ccccc3)C(=O)C[C@@H]1CCCc1cc3c(cnn3-c3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C31H29FN2O/c1-2-31-19-23(15-21-7-4-3-5-8-21)30(35)18-25(31)10-6-9-22-17-29-24(16-28(22)31)20-33-34(29)27-13-11-26(32)12-14-27/h3-5,7-8,11-17,20,25H,2,6,9-10,18-19H2,1H3/t25-,31+/m0/s1 |
| InChIKey | LKTUTDGBTRYGTJ-VVFBEHOQSA-N |
| XLogP | 7.21 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|