C25H24F4N2 — CID 86722406
(2R,7R)-2-ethyl-14-(4-fluorophenyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),5,12,15,17-pentaene (PubChem CID 86722406) has the molecular formula C25H24F4N2 and a molecular weight of 428.47 g/mol. Its IUPAC name is (2R,7R)-2-ethyl-14-(4-fluorophenyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),5,12,15,17-pentaene.
| Compound Name | (2R,7R)-2-ethyl-14-(4-fluorophenyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),5,12,15,17-pentaene |
|---|---|
| PubChem CID | 86722406 |
| Molecular Formula | C25H24F4N2 |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (2R,7R)-2-ethyl-14-(4-fluorophenyl)-5-(trifluoromethyl)-14,15-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),5,12,15,17-pentaene |
| SMILES | CC[C@@]12CCC(C(F)(F)F)=C[C@H]1CCCc1cc3c(cnn3-c3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C25H24F4N2/c1-2-24-11-10-19(25(27,28)29)14-18(24)5-3-4-16-13-23-17(12-22(16)24)15-30-31(23)21-8-6-20(26)7-9-21/h6-9,12-15,18H,2-5,10-11H2,1H3/t18-,24-/m1/s1 |
| InChIKey | ZWMBUXDHIMYILA-HOYKHHGWSA-N |
| XLogP | 7.05 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|