C8H12N2O — CID 123307049
N,3-dimethyl-2,3-dihydropyridine-5-carboxamide (PubChem CID 123307049) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is N,3-dimethyl-2,3-dihydropyridine-5-carboxamide.
| Compound Name | N,3-dimethyl-2,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 123307049 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | N,3-dimethyl-2,3-dihydropyridine-5-carboxamide |
| SMILES | CNC(=O)C1=CC(C)CN=C1 |
| InChI | InChI=1S/C8H12N2O/c1-6-3-7(5-10-4-6)8(11)9-2/h3,5-6H,4H2,1-2H3,(H,9,11) |
| InChIKey | ZDOBPLAJTNANOG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |