C9H14N2O — CID 123450050
N,2-dimethyl-3,4-dihydro-2H-azepine-6-carboxamide (PubChem CID 123450050) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is N,2-dimethyl-3,4-dihydro-2H-azepine-6-carboxamide.
| Compound Name | N,2-dimethyl-3,4-dihydro-2H-azepine-6-carboxamide |
|---|---|
| PubChem CID | 123450050 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | N,2-dimethyl-3,4-dihydro-2H-azepine-6-carboxamide |
| SMILES | CNC(=O)C1=CCCC(C)N=C1 |
| InChI | InChI=1S/C9H14N2O/c1-7-4-3-5-8(6-11-7)9(12)10-2/h5-7H,3-4H2,1-2H3,(H,10,12) |
| InChIKey | GTGXAVAAGJFYOC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |