C8H14N2O — CID 143931882
(E)-N,2-dimethyl-4-(methylideneamino)pent-2-enamide (PubChem CID 143931882) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (E)-N,2-dimethyl-4-(methylideneamino)pent-2-enamide.
| Compound Name | (E)-N,2-dimethyl-4-(methylideneamino)pent-2-enamide |
|---|---|
| PubChem CID | 143931882 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (E)-N,2-dimethyl-4-(methylideneamino)pent-2-enamide |
| SMILES | C=NC(C)/C=C(\C)C(=O)NC |
| InChI | InChI=1S/C8H14N2O/c1-6(8(11)10-4)5-7(2)9-3/h5,7H,3H2,1-2,4H3,(H,10,11)/b6-5+ |
| InChIKey | DRPFKBSUDAWERF-AATRIKPKSA-N |
| XLogP | 0.77 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|