C17H14F3N3 — CID 123307290
N'-[1-(4-methanimidoylphenyl)ethenyl]-N-[4-(trifluoromethyl)phenyl]methanimidamide (PubChem CID 123307290) has the molecular formula C17H14F3N3 and a molecular weight of 317.31 g/mol. Its IUPAC name is N'-[1-(4-methanimidoylphenyl)ethenyl]-N-[4-(trifluoromethyl)phenyl]methanimidamide.
| Compound Name | N'-[1-(4-methanimidoylphenyl)ethenyl]-N-[4-(trifluoromethyl)phenyl]methanimidamide |
|---|---|
| PubChem CID | 123307290 |
| Molecular Formula | C17H14F3N3 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N'-[1-(4-methanimidoylphenyl)ethenyl]-N-[4-(trifluoromethyl)phenyl]methanimidamide |
| SMILES | [H]/N=C/c1ccc(C(=C)/N=C/Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H14F3N3/c1-12(14-4-2-13(10-21)3-5-14)22-11-23-16-8-6-15(7-9-16)17(18,19)20/h2-11,21H,1H2,(H,22,23)/b21-10+ |
| InChIKey | IYNBTILGMSQPGV-UFFVCSGVSA-N |
| XLogP | 4.81 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|