C19H28F2N2O3S — CID 123308070
4-(3,5-difluoro-4-piperidin-4-yloxyphenyl)-1-propylsulfonylpiperidine (PubChem CID 123308070) has the molecular formula C19H28F2N2O3S and a molecular weight of 402.51 g/mol. Its IUPAC name is 4-(3,5-difluoro-4-piperidin-4-yloxyphenyl)-1-propylsulfonylpiperidine.
| Compound Name | 4-(3,5-difluoro-4-piperidin-4-yloxyphenyl)-1-propylsulfonylpiperidine |
|---|---|
| PubChem CID | 123308070 |
| Molecular Formula | C19H28F2N2O3S |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 4-(3,5-difluoro-4-piperidin-4-yloxyphenyl)-1-propylsulfonylpiperidine |
| SMILES | CCCS(=O)(=O)N1CCC(c2cc(F)c(OC3CCNCC3)c(F)c2)CC1 |
| InChI | InChI=1S/C19H28F2N2O3S/c1-2-11-27(24,25)23-9-5-14(6-10-23)15-12-17(20)19(18(21)13-15)26-16-3-7-22-8-4-16/h12-14,16,22H,2-11H2,1H3 |
| InChIKey | LUNMQTJFKCPRRV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |