C13H19NO6 — CID 123309732
2-O-tert-butyl 1-O,3-O-dimethyl 2-isocyanopropane-1,2,3-tricarboxylate (PubChem CID 123309732) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-O-tert-butyl 1-O,3-O-dimethyl 2-isocyanopropane-1,2,3-tricarboxylate.
| Compound Name | 2-O-tert-butyl 1-O,3-O-dimethyl 2-isocyanopropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 123309732 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-O-tert-butyl 1-O,3-O-dimethyl 2-isocyanopropane-1,2,3-tricarboxylate |
| SMILES | [C-]#[N+]C(CC(=O)OC)(CC(=O)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H19NO6/c1-12(2,3)20-11(17)13(14-4,7-9(15)18-5)8-10(16)19-6/h7-8H2,1-3,5-6H3 |
| InChIKey | RUZFRCJYKFQTJG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 83.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|