C15H26O5 — CID 86597609
1-O-tert-butyl 4-O-methyl 2-hydroxy-2-(4-methylpent-1-enyl)butanedioate (PubChem CID 86597609) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-methyl 2-hydroxy-2-(4-methylpent-1-enyl)butanedioate.
| Compound Name | 1-O-tert-butyl 4-O-methyl 2-hydroxy-2-(4-methylpent-1-enyl)butanedioate |
|---|---|
| PubChem CID | 86597609 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 1-O-tert-butyl 4-O-methyl 2-hydroxy-2-(4-methylpent-1-enyl)butanedioate |
| SMILES | COC(=O)CC(O)(C=CCC(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26O5/c1-11(2)8-7-9-15(18,10-12(16)19-6)13(17)20-14(3,4)5/h7,9,11,18H,8,10H2,1-6H3 |
| InChIKey | NCNQHFGLQQZISY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|