C15H26O5 — CID 150690953
1-O-butyl 4-O-methyl 2-hydroxy-2-(4-methylpent-1-enyl)butanedioate (PubChem CID 150690953) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-O-butyl 4-O-methyl 2-hydroxy-2-(4-methylpent-1-enyl)butanedioate.
| Compound Name | 1-O-butyl 4-O-methyl 2-hydroxy-2-(4-methylpent-1-enyl)butanedioate |
|---|---|
| PubChem CID | 150690953 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 1-O-butyl 4-O-methyl 2-hydroxy-2-(4-methylpent-1-enyl)butanedioate |
| SMILES | CCCCOC(=O)C(O)(C=CCC(C)C)CC(=O)OC |
| InChI | InChI=1S/C15H26O5/c1-5-6-10-20-14(17)15(18,11-13(16)19-4)9-7-8-12(2)3/h7,9,12,18H,5-6,8,10-11H2,1-4H3 |
| InChIKey | JJWDWAHVKHLBLH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|