C48H39N2OS+ — CID 123309860
2-[4-[2-(8-methoxy-1-methylquinolin-1-ium-5-yl)-11,11,12,12-tetramethylindeno[2,1-a]fluoren-9-yl]phenyl]-1,3-benzothiazole (PubChem CID 123309860) has the molecular formula C48H39N2OS+ and a molecular weight of 691.92 g/mol. Its IUPAC name is 2-[4-[2-(8-methoxy-1-methylquinolin-1-ium-5-yl)-11,11,12,12-tetramethylindeno[2,1-a]fluoren-9-yl]phenyl]-1,3-benzothiazole.
| Compound Name | 2-[4-[2-(8-methoxy-1-methylquinolin-1-ium-5-yl)-11,11,12,12-tetramethylindeno[2,1-a]fluoren-9-yl]phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 123309860 |
| Molecular Formula | C48H39N2OS+ |
| Molecular Weight | 691.92 g/mol |
| Exact Mass | 691.28 |
| IUPAC Name | 2-[4-[2-(8-methoxy-1-methylquinolin-1-ium-5-yl)-11,11,12,12-tetramethylindeno[2,1-a]fluoren-9-yl]phenyl]-1,3-benzothiazole |
| SMILES | COc1ccc(-c2ccc3c(c2)C(C)(C)c2c-3ccc3c2C(C)(C)c2cc(-c4ccc(-c5nc6ccccc6s5)cc4)ccc2-3)c2ccc[n+](C)c12 |
| InChI | InChI=1S/C48H39N2OS/c1-47(2)38-26-30(28-13-15-29(16-14-28)46-49-40-11-7-8-12-42(40)52-46)17-19-33(38)35-21-22-36-34-20-18-31(27-39(34)48(3,4)44(36)43(35)47)32-23-24-41(51-6)45-37(32)10-9-25-50(45)5/h7-27H,1-6H3/q+1 |
| InChIKey | GFZVYCQITGEDKH-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.92 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|