C14H24OS — CID 123311410
4-(8-methylnona-1,3,5-trien-4-ylsulfanyl)butan-1-ol (PubChem CID 123311410) has the molecular formula C14H24OS and a molecular weight of 240.41 g/mol. Its IUPAC name is 4-(8-methylnona-1,3,5-trien-4-ylsulfanyl)butan-1-ol.
| Compound Name | 4-(8-methylnona-1,3,5-trien-4-ylsulfanyl)butan-1-ol |
|---|---|
| PubChem CID | 123311410 |
| Molecular Formula | C14H24OS |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 4-(8-methylnona-1,3,5-trien-4-ylsulfanyl)butan-1-ol |
| SMILES | C=CC=C(C=CCC(C)C)SCCCCO |
| InChI | InChI=1S/C14H24OS/c1-4-8-14(10-7-9-13(2)3)16-12-6-5-11-15/h4,7-8,10,13,15H,1,5-6,9,11-12H2,2-3H3 |
| InChIKey | GCMGJSFIZVAZLL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|