C27H40B2N5O4+ — CID 123311891
3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[4,5,5-trimethyl-2-(1-propan-2-ylpyrazol-4-yl)-1,3,2-dioxaborolan-4-yl]methyl]pyrazol-1-ium-1-yl]methyl]pyridine (PubChem CID 123311891) has the molecular formula C27H40B2N5O4+ and a molecular weight of 520.27 g/mol. Its IUPAC name is 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[4,5,5-trimethyl-2-(1-propan-2-ylpyrazol-4-yl)-1,3,2-dioxaborolan-4-yl]methyl]pyrazol-1-ium-1-yl]methyl]pyridine.
| Compound Name | 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[4,5,5-trimethyl-2-(1-propan-2-ylpyrazol-4-yl)-1,3,2-dioxaborolan-4-yl]methyl]pyrazol-1-ium-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 123311891 |
| Molecular Formula | C27H40B2N5O4+ |
| Molecular Weight | 520.27 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[4,5,5-trimethyl-2-(1-propan-2-ylpyrazol-4-yl)-1,3,2-dioxaborolan-4-yl]methyl]pyrazol-1-ium-1-yl]methyl]pyridine |
| SMILES | CC(C)n1cc(B2OC(C)(C)C(C)(Cn3cc(B4OC(C)(C)C(C)(C)O4)c[n+]3Cc3cccnc3)O2)cn1 |
| InChI | InChI=1S/C27H40B2N5O4/c1-20(2)34-18-22(14-31-34)28-37-26(7,8)27(9,38-28)19-33-17-23(29-35-24(3,4)25(5,6)36-29)16-32(33)15-21-11-10-12-30-13-21/h10-14,16-18,20H,15,19H2,1-9H3/q+1 |
| InChIKey | AUJLDZUFRPYDLC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|