C22H39NO4 — CID 123311958
2,3,3a,4,5,6,7,7a-octahydro-1H-indene;ethyl 3-(4-ethoxycyclohexyl)prop-2-ynoate;hydroxylamine (PubChem CID 123311958) has the molecular formula C22H39NO4 and a molecular weight of 381.56 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indene;ethyl 3-(4-ethoxycyclohexyl)prop-2-ynoate;hydroxylamine.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indene;ethyl 3-(4-ethoxycyclohexyl)prop-2-ynoate;hydroxylamine |
|---|---|
| PubChem CID | 123311958 |
| Molecular Formula | C22H39NO4 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.29 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indene;ethyl 3-(4-ethoxycyclohexyl)prop-2-ynoate;hydroxylamine |
| SMILES | C1CCC2CCCC2C1.CCOC(=O)C#CC1CCC(OCC)CC1.NO |
| InChI | InChI=1S/C13H20O3.C9H16.H3NO/c1-3-15-12-8-5-11(6-9-12)7-10-13(14)16-4-2;1-2-5-9-7-3-6-8(9)4-1;1-2/h11-12H,3-6,8-9H2,1-2H3;8-9H,1-7H2;2H,1H2 |
| InChIKey | PLYJMLIJAFMJFA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|