About 3-cyclopropylprop-2-ynyl ethyl carbonate
3-cyclopropylprop-2-ynyl ethyl carbonate (PubChem CID 164513829) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 3-cyclopropylprop-2-ynyl ethyl carbonate.
Molecular Properties
| Compound Name | 3-cyclopropylprop-2-ynyl ethyl carbonate |
| PubChem CID | 164513829 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 3-cyclopropylprop-2-ynyl ethyl carbonate |
| SMILES | CCOC(=O)OCC#CC1CC1 |
| InChI | InChI=1S/C9H12O3/c1-2-11-9(10)12-7-3-4-8-5-6-8/h8H,2,5-7H2,1H3 |
| InChIKey | WOBNTKZHEVQFQE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopropylprop-2-ynyl ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropylprop-2-ynyl ethyl carbonate?
The IUPAC name of 3-cyclopropylprop-2-ynyl ethyl carbonate (CID 164513829) is 3-cyclopropylprop-2-ynyl ethyl carbonate.
What is the SMILES notation for 3-cyclopropylprop-2-ynyl ethyl carbonate?
The canonical SMILES for 3-cyclopropylprop-2-ynyl ethyl carbonate is CCOC(=O)OCC#CC1CC1.
What is the InChIKey of 3-cyclopropylprop-2-ynyl ethyl carbonate?
The InChIKey is WOBNTKZHEVQFQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-2-11-9(10)12-7-3-4-8-5-6-8/h8H,2,5-7H2,1H3.
What are the key properties of 3-cyclopropylprop-2-ynyl ethyl carbonate?
3-cyclopropylprop-2-ynyl ethyl carbonate has a molecular weight of 168.19 g/mol, XLogP of 1.57, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropylprop-2-ynyl ethyl carbonate is sourced from PubChem (CID 164513829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).