C18H22BrF3O2 — CID 159209018
3-bromoprop-1-ynylcyclopropane;ethyl 5-cyclopropyl-2-(2,2,2-trifluoroethyl)pent-4-ynoate (PubChem CID 159209018) has the molecular formula C18H22BrF3O2 and a molecular weight of 407.27 g/mol. Its IUPAC name is 3-bromoprop-1-ynylcyclopropane;ethyl 5-cyclopropyl-2-(2,2,2-trifluoroethyl)pent-4-ynoate.
| Compound Name | 3-bromoprop-1-ynylcyclopropane;ethyl 5-cyclopropyl-2-(2,2,2-trifluoroethyl)pent-4-ynoate |
|---|---|
| PubChem CID | 159209018 |
| Molecular Formula | C18H22BrF3O2 |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 3-bromoprop-1-ynylcyclopropane;ethyl 5-cyclopropyl-2-(2,2,2-trifluoroethyl)pent-4-ynoate |
| SMILES | BrCC#CC1CC1.CCOC(=O)C(CC#CC1CC1)CC(F)(F)F |
| InChI | InChI=1S/C12H15F3O2.C6H7Br/c1-2-17-11(16)10(8-12(13,14)15)5-3-4-9-6-7-9;7-5-1-2-6-3-4-6/h9-10H,2,5-8H2,1H3;6H,3-5H2 |
| InChIKey | KQGFBKOIKQLWMQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|