C10H16N2O4 — CID 123311990
6-hydroxy-1-propan-2-yl-5-propoxypyrimidine-2,4-dione (PubChem CID 123311990) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 6-hydroxy-1-propan-2-yl-5-propoxypyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1-propan-2-yl-5-propoxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123311990 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 6-hydroxy-1-propan-2-yl-5-propoxypyrimidine-2,4-dione |
| SMILES | CCCOc1c(O)n(C(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H16N2O4/c1-4-5-16-7-8(13)11-10(15)12(6(2)3)9(7)14/h6,14H,4-5H2,1-3H3,(H,11,13,15) |
| InChIKey | ZDKWYYBMIIXNQT-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |