C10H16N2 — CID 123312462
3-methyl-2-(4-methylpenta-1,3-dien-3-yl)-2,4-dihydroimidazole (PubChem CID 123312462) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)-2,4-dihydroimidazole.
| Compound Name | 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)-2,4-dihydroimidazole |
|---|---|
| PubChem CID | 123312462 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)-2,4-dihydroimidazole |
| SMILES | C=CC(=C(C)C)C1N=CCN1C |
| InChI | InChI=1S/C10H16N2/c1-5-9(8(2)3)10-11-6-7-12(10)4/h5-6,10H,1,7H2,2-4H3 |
| InChIKey | XBACOBUYDWJWGN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|