C21H35N5O6 — CID 123312816
5-amino-2-[2-[3-(2-aminooxyethoxy)propanoylamino]butanoylamino]-N-[4-(hydroxymethyl)phenyl]pentanamide (PubChem CID 123312816) has the molecular formula C21H35N5O6 and a molecular weight of 453.54 g/mol. Its IUPAC name is 5-amino-2-[2-[3-(2-aminooxyethoxy)propanoylamino]butanoylamino]-N-[4-(hydroxymethyl)phenyl]pentanamide.
| Compound Name | 5-amino-2-[2-[3-(2-aminooxyethoxy)propanoylamino]butanoylamino]-N-[4-(hydroxymethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 123312816 |
| Molecular Formula | C21H35N5O6 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 5-amino-2-[2-[3-(2-aminooxyethoxy)propanoylamino]butanoylamino]-N-[4-(hydroxymethyl)phenyl]pentanamide |
| SMILES | CCC(NC(=O)CCOCCON)C(=O)NC(CCCN)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C21H35N5O6/c1-2-17(25-19(28)9-11-31-12-13-32-23)20(29)26-18(4-3-10-22)21(30)24-16-7-5-15(14-27)6-8-16/h5-8,17-18,27H,2-4,9-14,22-23H2,1H3,(H,24,30)(H,25,28)(H,26,29) |
| InChIKey | QURGWMQZKCCLCU-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|