C17H25N3O6 — CID 170453576
2-[2-[[6-amino-1-[4-(hydroxymethyl)anilino]-1-oxohexan-2-yl]amino]-2-oxoethoxy]acetic acid (PubChem CID 170453576) has the molecular formula C17H25N3O6 and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-[2-[[6-amino-1-[4-(hydroxymethyl)anilino]-1-oxohexan-2-yl]amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[[6-amino-1-[4-(hydroxymethyl)anilino]-1-oxohexan-2-yl]amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 170453576 |
| Molecular Formula | C17H25N3O6 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-[2-[[6-amino-1-[4-(hydroxymethyl)anilino]-1-oxohexan-2-yl]amino]-2-oxoethoxy]acetic acid |
| SMILES | NCCCCC(NC(=O)COCC(=O)O)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C17H25N3O6/c18-8-2-1-3-14(20-15(22)10-26-11-16(23)24)17(25)19-13-6-4-12(9-21)5-7-13/h4-7,14,21H,1-3,8-11,18H2,(H,19,25)(H,20,22)(H,23,24) |
| InChIKey | ROMJELGDZQHJNZ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|