About 4-iodopyridine-2,3-diimine
4-iodopyridine-2,3-diimine (PubChem CID 123313142) has the molecular formula C5H4IN3
and a molecular weight of 233.01 g/mol. Its IUPAC name is 4-iodopyridine-2,3-diimine.
Molecular Properties
| Compound Name | 4-iodopyridine-2,3-diimine |
| PubChem CID | 123313142 |
| Molecular Formula | C5H4IN3 |
| Molecular Weight | 233.01 g/mol |
| Exact Mass | 232.94 |
| IUPAC Name | 4-iodopyridine-2,3-diimine |
| SMILES | [H]/N=C1\N=CC=C(I)\C1=N\[H] |
| InChI | InChI=1S/C5H4IN3/c6-3-1-2-9-5(8)4(3)7/h1-2,7-8H/b7-4-,8-5- |
| InChIKey | OWUQPFOAWXKKEQ-IUNAMMOKSA-N |
| XLogP | 1.39 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.01 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodopyridine-2,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodopyridine-2,3-diimine?
The IUPAC name of 4-iodopyridine-2,3-diimine (CID 123313142) is 4-iodopyridine-2,3-diimine.
What is the SMILES notation for 4-iodopyridine-2,3-diimine?
The canonical SMILES for 4-iodopyridine-2,3-diimine is [H]/N=C1\N=CC=C(I)\C1=N\[H].
What is the InChIKey of 4-iodopyridine-2,3-diimine?
The InChIKey is OWUQPFOAWXKKEQ-IUNAMMOKSA-N. The full InChI is InChI=1S/C5H4IN3/c6-3-1-2-9-5(8)4(3)7/h1-2,7-8H/b7-4-,8-5-.
What are the key properties of 4-iodopyridine-2,3-diimine?
4-iodopyridine-2,3-diimine has a molecular weight of 233.01 g/mol, XLogP of 1.39, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodopyridine-2,3-diimine is sourced from PubChem (CID 123313142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).