About cobalt;iron;pyridine-2,3-diimine
cobalt;iron;pyridine-2,3-diimine (PubChem CID 159612458) has the molecular formula C5H5CoFeN3
and a molecular weight of 221.89 g/mol. Its IUPAC name is cobalt;iron;pyridine-2,3-diimine.
Molecular Properties
| Compound Name | cobalt;iron;pyridine-2,3-diimine |
| PubChem CID | 159612458 |
| Molecular Formula | C5H5CoFeN3 |
| Molecular Weight | 221.89 g/mol |
| Exact Mass | 221.92 |
| IUPAC Name | cobalt;iron;pyridine-2,3-diimine |
| SMILES | [Co].[Fe].[H]/N=C1\N=CC=C\C1=N/[H] |
| InChI | InChI=1S/C5H5N3.Co.Fe/c6-4-2-1-3-8-5(4)7;;/h1-3,6-7H;;/b6-4+,7-5-;; |
| InChIKey | MMWGRPAQUJWPRT-SZTRGTFMSA-N |
| XLogP | 0.62 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.89 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cobalt;iron;pyridine-2,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;iron;pyridine-2,3-diimine?
The IUPAC name of cobalt;iron;pyridine-2,3-diimine (CID 159612458) is cobalt;iron;pyridine-2,3-diimine.
What is the SMILES notation for cobalt;iron;pyridine-2,3-diimine?
The canonical SMILES for cobalt;iron;pyridine-2,3-diimine is [Co].[Fe].[H]/N=C1\N=CC=C\C1=N/[H].
What is the InChIKey of cobalt;iron;pyridine-2,3-diimine?
The InChIKey is MMWGRPAQUJWPRT-SZTRGTFMSA-N. The full InChI is InChI=1S/C5H5N3.Co.Fe/c6-4-2-1-3-8-5(4)7;;/h1-3,6-7H;;/b6-4+,7-5-;;.
What are the key properties of cobalt;iron;pyridine-2,3-diimine?
cobalt;iron;pyridine-2,3-diimine has a molecular weight of 221.89 g/mol, XLogP of 0.62, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;iron;pyridine-2,3-diimine is sourced from PubChem (CID 159612458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).