C34H37ClN6O4 — CID 123314227
N-[3-[[6-(4-chlorophenyl)-4-[2-(ethylamino)-2-oxoethyl]-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-8-yl]oxy]propyl]-3-(2-hydroxypropan-2-yl)benzamide (PubChem CID 123314227) has the molecular formula C34H37ClN6O4 and a molecular weight of 629.16 g/mol. Its IUPAC name is N-[3-[[6-(4-chlorophenyl)-4-[2-(ethylamino)-2-oxoethyl]-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-8-yl]oxy]propyl]-3-(2-hydroxypropan-2-yl)benzamide.
| Compound Name | N-[3-[[6-(4-chlorophenyl)-4-[2-(ethylamino)-2-oxoethyl]-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-8-yl]oxy]propyl]-3-(2-hydroxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 123314227 |
| Molecular Formula | C34H37ClN6O4 |
| Molecular Weight | 629.16 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | N-[3-[[6-(4-chlorophenyl)-4-[2-(ethylamino)-2-oxoethyl]-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-8-yl]oxy]propyl]-3-(2-hydroxypropan-2-yl)benzamide |
| SMILES | CCNC(=O)CC1N=C(c2ccc(Cl)cc2)c2cc(OCCCNC(=O)c3cccc(C(C)(C)O)c3)ccc2-n2c(C)nnc21 |
| InChI | InChI=1S/C34H37ClN6O4/c1-5-36-30(42)20-28-32-40-39-21(2)41(32)29-15-14-26(19-27(29)31(38-28)22-10-12-25(35)13-11-22)45-17-7-16-37-33(43)23-8-6-9-24(18-23)34(3,4)44/h6,8-15,18-19,28,44H,5,7,16-17,20H2,1-4H3,(H,36,42)(H,37,43) |
| InChIKey | VZVUSRFXGXRBBJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 130.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.16 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|