C33H37ClN6O4Si — CID 123502709
N-[2-[[6-(4-chlorophenyl)-4-[2-(ethylamino)-2-oxoethyl]-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-8-yl]oxy]ethyl]-4-[[hydroxy(dimethyl)silyl]methyl]benzamide (PubChem CID 123502709) has the molecular formula C33H37ClN6O4Si and a molecular weight of 645.24 g/mol. Its IUPAC name is N-[2-[[6-(4-chlorophenyl)-4-[2-(ethylamino)-2-oxoethyl]-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-8-yl]oxy]ethyl]-4-[[hydroxy(dimethyl)silyl]methyl]benzamide.
| Compound Name | N-[2-[[6-(4-chlorophenyl)-4-[2-(ethylamino)-2-oxoethyl]-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-8-yl]oxy]ethyl]-4-[[hydroxy(dimethyl)silyl]methyl]benzamide |
|---|---|
| PubChem CID | 123502709 |
| Molecular Formula | C33H37ClN6O4Si |
| Molecular Weight | 645.24 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | N-[2-[[6-(4-chlorophenyl)-4-[2-(ethylamino)-2-oxoethyl]-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-8-yl]oxy]ethyl]-4-[[hydroxy(dimethyl)silyl]methyl]benzamide |
| SMILES | CCNC(=O)CC1N=C(c2ccc(Cl)cc2)c2cc(OCCNC(=O)c3ccc(C[Si](C)(C)O)cc3)ccc2-n2c(C)nnc21 |
| InChI | InChI=1S/C33H37ClN6O4Si/c1-5-35-30(41)19-28-32-39-38-21(2)40(32)29-15-14-26(18-27(29)31(37-28)23-10-12-25(34)13-11-23)44-17-16-36-33(42)24-8-6-22(7-9-24)20-45(3,4)43/h6-15,18,28,43H,5,16-17,19-20H2,1-4H3,(H,35,41)(H,36,42) |
| InChIKey | GRNKHYKCNJIFFG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 130.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.24 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|