C29H30ClN7O2 — CID 71291134
2-[(4S)-6-(4-chlorophenyl)-8-[[4-(hydrazinylmethyl)phenyl]methoxy]-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-N-ethylacetamide (PubChem CID 71291134) has the molecular formula C29H30ClN7O2 and a molecular weight of 544.06 g/mol. Its IUPAC name is 2-[(4S)-6-(4-chlorophenyl)-8-[[4-(hydrazinylmethyl)phenyl]methoxy]-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-N-ethylacetamide.
| Compound Name | 2-[(4S)-6-(4-chlorophenyl)-8-[[4-(hydrazinylmethyl)phenyl]methoxy]-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 71291134 |
| Molecular Formula | C29H30ClN7O2 |
| Molecular Weight | 544.06 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | 2-[(4S)-6-(4-chlorophenyl)-8-[[4-(hydrazinylmethyl)phenyl]methoxy]-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)C[C@@H]1N=C(c2ccc(Cl)cc2)c2cc(OCc3ccc(CNN)cc3)ccc2-n2c(C)nnc21 |
| InChI | InChI=1S/C29H30ClN7O2/c1-3-32-27(38)15-25-29-36-35-18(2)37(29)26-13-12-23(39-17-20-6-4-19(5-7-20)16-33-31)14-24(26)28(34-25)21-8-10-22(30)11-9-21/h4-14,25,33H,3,15-17,31H2,1-2H3,(H,32,38)/t25-/m0/s1 |
| InChIKey | BLCXNBOBUXYMKI-VWLOTQADSA-N |
| XLogP | 4.19 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.06 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|