C20H23Cl2FN4O3 — CID 123314832
N-[[5-[[[amino-(4-chlorophenyl)carbamoyl]amino]methyl]-4-chloro-2-fluorophenyl]methyl]-3-hydroxy-2,2-dimethylpropanamide (PubChem CID 123314832) has the molecular formula C20H23Cl2FN4O3 and a molecular weight of 457.33 g/mol. Its IUPAC name is N-[[5-[[[amino-(4-chlorophenyl)carbamoyl]amino]methyl]-4-chloro-2-fluorophenyl]methyl]-3-hydroxy-2,2-dimethylpropanamide.
| Compound Name | N-[[5-[[[amino-(4-chlorophenyl)carbamoyl]amino]methyl]-4-chloro-2-fluorophenyl]methyl]-3-hydroxy-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 123314832 |
| Molecular Formula | C20H23Cl2FN4O3 |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | N-[[5-[[[amino-(4-chlorophenyl)carbamoyl]amino]methyl]-4-chloro-2-fluorophenyl]methyl]-3-hydroxy-2,2-dimethylpropanamide |
| SMILES | CC(C)(CO)C(=O)NCc1cc(CNC(=O)N(N)c2ccc(Cl)cc2)c(Cl)cc1F |
| InChI | InChI=1S/C20H23Cl2FN4O3/c1-20(2,11-28)18(29)25-10-13-7-12(16(22)8-17(13)23)9-26-19(30)27(24)15-5-3-14(21)4-6-15/h3-8,28H,9-11,24H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | DRFDEMPTNCDSDC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|