C12H14ClF2NO3S — CID 136538213
N-[(4-chloro-2,5-difluorophenyl)methyl]-2-methyl-2-methylsulfonylpropanamide (PubChem CID 136538213) has the molecular formula C12H14ClF2NO3S and a molecular weight of 325.76 g/mol. Its IUPAC name is N-[(4-chloro-2,5-difluorophenyl)methyl]-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | N-[(4-chloro-2,5-difluorophenyl)methyl]-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 136538213 |
| Molecular Formula | C12H14ClF2NO3S |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N-[(4-chloro-2,5-difluorophenyl)methyl]-2-methyl-2-methylsulfonylpropanamide |
| SMILES | CC(C)(C(=O)NCc1cc(F)c(Cl)cc1F)S(C)(=O)=O |
| InChI | InChI=1S/C12H14ClF2NO3S/c1-12(2,20(3,18)19)11(17)16-6-7-4-10(15)8(13)5-9(7)14/h4-5H,6H2,1-3H3,(H,16,17) |
| InChIKey | UOZFTJUYWIRCLJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|