C14H16ClF4N3O3 — CID 90065783
tert-butyl N-[2-chloro-4-fluoro-5-[[(2,2,2-trifluoroacetyl)amino]methyl]anilino]carbamate (PubChem CID 90065783) has the molecular formula C14H16ClF4N3O3 and a molecular weight of 385.75 g/mol. Its IUPAC name is tert-butyl N-[2-chloro-4-fluoro-5-[[(2,2,2-trifluoroacetyl)amino]methyl]anilino]carbamate.
| Compound Name | tert-butyl N-[2-chloro-4-fluoro-5-[[(2,2,2-trifluoroacetyl)amino]methyl]anilino]carbamate |
|---|---|
| PubChem CID | 90065783 |
| Molecular Formula | C14H16ClF4N3O3 |
| Molecular Weight | 385.75 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | tert-butyl N-[2-chloro-4-fluoro-5-[[(2,2,2-trifluoroacetyl)amino]methyl]anilino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNc1cc(CNC(=O)C(F)(F)F)c(F)cc1Cl |
| InChI | InChI=1S/C14H16ClF4N3O3/c1-13(2,3)25-12(24)22-21-10-4-7(9(16)5-8(10)15)6-20-11(23)14(17,18)19/h4-5,21H,6H2,1-3H3,(H,20,23)(H,22,24) |
| InChIKey | LMUYVCCPBZKHES-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.75 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|