C17H25ClFN3O3 — CID 90019676
tert-butyl N-[6-chloro-3-[(2,2-dimethylpropanoylamino)methyl]-2-fluoroanilino]carbamate (PubChem CID 90019676) has the molecular formula C17H25ClFN3O3 and a molecular weight of 373.86 g/mol. Its IUPAC name is tert-butyl N-[6-chloro-3-[(2,2-dimethylpropanoylamino)methyl]-2-fluoroanilino]carbamate.
| Compound Name | tert-butyl N-[6-chloro-3-[(2,2-dimethylpropanoylamino)methyl]-2-fluoroanilino]carbamate |
|---|---|
| PubChem CID | 90019676 |
| Molecular Formula | C17H25ClFN3O3 |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | tert-butyl N-[6-chloro-3-[(2,2-dimethylpropanoylamino)methyl]-2-fluoroanilino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNc1c(Cl)ccc(CNC(=O)C(C)(C)C)c1F |
| InChI | InChI=1S/C17H25ClFN3O3/c1-16(2,3)14(23)20-9-10-7-8-11(18)13(12(10)19)21-22-15(24)25-17(4,5)6/h7-8,21H,9H2,1-6H3,(H,20,23)(H,22,24) |
| InChIKey | CSRDPKHNFOKBJH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|