C16H20Cl2FNO3 — CID 163240886
tert-butyl 5-[(3,4-dichloro-2-fluorophenyl)methylamino]-5-oxopentanoate (PubChem CID 163240886) has the molecular formula C16H20Cl2FNO3 and a molecular weight of 364.24 g/mol. Its IUPAC name is tert-butyl 5-[(3,4-dichloro-2-fluorophenyl)methylamino]-5-oxopentanoate.
| Compound Name | tert-butyl 5-[(3,4-dichloro-2-fluorophenyl)methylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 163240886 |
| Molecular Formula | C16H20Cl2FNO3 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | tert-butyl 5-[(3,4-dichloro-2-fluorophenyl)methylamino]-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)CCCC(=O)NCc1ccc(Cl)c(Cl)c1F |
| InChI | InChI=1S/C16H20Cl2FNO3/c1-16(2,3)23-13(22)6-4-5-12(21)20-9-10-7-8-11(17)14(18)15(10)19/h7-8H,4-6,9H2,1-3H3,(H,20,21) |
| InChIKey | IDTWTBZZXMUESC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|