C12H12ClF2N5O — CID 146140533
1-[(4-chloro-2,5-difluorophenyl)methyl]-3-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]urea (PubChem CID 146140533) has the molecular formula C12H12ClF2N5O and a molecular weight of 315.71 g/mol. Its IUPAC name is 1-[(4-chloro-2,5-difluorophenyl)methyl]-3-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]urea.
| Compound Name | 1-[(4-chloro-2,5-difluorophenyl)methyl]-3-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 146140533 |
| Molecular Formula | C12H12ClF2N5O |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 1-[(4-chloro-2,5-difluorophenyl)methyl]-3-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]urea |
| SMILES | Cc1nc(CNC(=O)NCc2cc(F)c(Cl)cc2F)n[nH]1 |
| InChI | InChI=1S/C12H12ClF2N5O/c1-6-18-11(20-19-6)5-17-12(21)16-4-7-2-10(15)8(13)3-9(7)14/h2-3H,4-5H2,1H3,(H2,16,17,21)(H,18,19,20) |
| InChIKey | MVXBKFRDUNZZIN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|