C26H33F2NO5S — CID 123315439
3-[4-[2,5-difluoro-4-[(3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl]oxan-4-yl]oxypropan-1-ol (PubChem CID 123315439) has the molecular formula C26H33F2NO5S and a molecular weight of 509.62 g/mol. Its IUPAC name is 3-[4-[2,5-difluoro-4-[(3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl]oxan-4-yl]oxypropan-1-ol.
| Compound Name | 3-[4-[2,5-difluoro-4-[(3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl]oxan-4-yl]oxypropan-1-ol |
|---|---|
| PubChem CID | 123315439 |
| Molecular Formula | C26H33F2NO5S |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 3-[4-[2,5-difluoro-4-[(3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl]oxan-4-yl]oxypropan-1-ol |
| SMILES | CC1CCC(c2ccccc2)S(=O)(=O)N1Cc1cc(F)c(C2(OCCCO)CCOCC2)cc1F |
| InChI | InChI=1S/C26H33F2NO5S/c1-19-8-9-25(20-6-3-2-4-7-20)35(31,32)29(19)18-21-16-24(28)22(17-23(21)27)26(34-13-5-12-30)10-14-33-15-11-26/h2-4,6-7,16-17,19,25,30H,5,8-15,18H2,1H3 |
| InChIKey | PJXMHJTYURREJD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|