C26H31F2NO4S — CID 123776683
2-[[2,5-difluoro-4-(4-prop-2-enoxyoxan-4-yl)phenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide (PubChem CID 123776683) has the molecular formula C26H31F2NO4S and a molecular weight of 491.60 g/mol. Its IUPAC name is 2-[[2,5-difluoro-4-(4-prop-2-enoxyoxan-4-yl)phenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide.
| Compound Name | 2-[[2,5-difluoro-4-(4-prop-2-enoxyoxan-4-yl)phenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 123776683 |
| Molecular Formula | C26H31F2NO4S |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 2-[[2,5-difluoro-4-(4-prop-2-enoxyoxan-4-yl)phenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide |
| SMILES | C=CCOC1(c2cc(F)c(CN3C(C)CCC(c4ccccc4)S3(=O)=O)cc2F)CCOCC1 |
| InChI | InChI=1S/C26H31F2NO4S/c1-3-13-33-26(11-14-32-15-12-26)22-17-23(27)21(16-24(22)28)18-29-19(2)9-10-25(34(29,30)31)20-7-5-4-6-8-20/h3-8,16-17,19,25H,1,9-15,18H2,2H3 |
| InChIKey | QMTAKAYKRVFXOD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|