C17H26N6O3 — CID 123315590
2-(2-amino-3-cyclopentylpropyl)-5-(6-aminopurin-9-yl)oxolane-3,4-diol (PubChem CID 123315590) has the molecular formula C17H26N6O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-(2-amino-3-cyclopentylpropyl)-5-(6-aminopurin-9-yl)oxolane-3,4-diol.
| Compound Name | 2-(2-amino-3-cyclopentylpropyl)-5-(6-aminopurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 123315590 |
| Molecular Formula | C17H26N6O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-(2-amino-3-cyclopentylpropyl)-5-(6-aminopurin-9-yl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2C1OC(CC(N)CC2CCCC2)C(O)C1O |
| InChI | InChI=1S/C17H26N6O3/c18-10(5-9-3-1-2-4-9)6-11-13(24)14(25)17(26-11)23-8-22-12-15(19)20-7-21-16(12)23/h7-11,13-14,17,24-25H,1-6,18H2,(H2,19,20,21) |
| InChIKey | CXQUQMCSPKYDHP-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 145.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |