C22H18F6N4O3 — CID 123315845
(3R,4S)-3-(1,3-diiminopropan-2-yl)-1-oxo-2-(2,2,2-trifluoroethyl)-N-[3-(trifluoromethoxy)phenyl]-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 123315845) has the molecular formula C22H18F6N4O3 and a molecular weight of 500.40 g/mol. Its IUPAC name is (3R,4S)-3-(1,3-diiminopropan-2-yl)-1-oxo-2-(2,2,2-trifluoroethyl)-N-[3-(trifluoromethoxy)phenyl]-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4S)-3-(1,3-diiminopropan-2-yl)-1-oxo-2-(2,2,2-trifluoroethyl)-N-[3-(trifluoromethoxy)phenyl]-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 123315845 |
| Molecular Formula | C22H18F6N4O3 |
| Molecular Weight | 500.40 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | (3R,4S)-3-(1,3-diiminopropan-2-yl)-1-oxo-2-(2,2,2-trifluoroethyl)-N-[3-(trifluoromethoxy)phenyl]-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | [H]/N=C/C(/C=N/[H])[C@@H]1[C@@H](C(=O)Nc2cccc(OC(F)(F)F)c2)c2ccccc2C(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C22H18F6N4O3/c23-21(24,25)11-32-18(12(9-29)10-30)17(15-6-1-2-7-16(15)20(32)34)19(33)31-13-4-3-5-14(8-13)35-22(26,27)28/h1-10,12,17-18,29-30H,11H2,(H,31,33)/b29-9+,30-10+/t17-,18+/m0/s1 |
| InChIKey | XQLIBPKOBWIZDK-RUMZBDQISA-N |
| XLogP | 4.61 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|