C12H36O14Si10 — CID 123316119
hex-5-enyl-methoxy-dimethylsilane;methoxy(dimethyl)silane;tris[hydroxy(oxo)silyl]-tris[hydroxy(oxo)silyl]silylsilane (PubChem CID 123316119) has the molecular formula C12H36O14Si10 and a molecular weight of 685.27 g/mol. Its IUPAC name is hex-5-enyl-methoxy-dimethylsilane;methoxy(dimethyl)silane;tris[hydroxy(oxo)silyl]-tris[hydroxy(oxo)silyl]silylsilane.
| Compound Name | hex-5-enyl-methoxy-dimethylsilane;methoxy(dimethyl)silane;tris[hydroxy(oxo)silyl]-tris[hydroxy(oxo)silyl]silylsilane |
|---|---|
| PubChem CID | 123316119 |
| Molecular Formula | C12H36O14Si10 |
| Molecular Weight | 685.27 g/mol |
| Exact Mass | 683.98 |
| IUPAC Name | hex-5-enyl-methoxy-dimethylsilane;methoxy(dimethyl)silane;tris[hydroxy(oxo)silyl]-tris[hydroxy(oxo)silyl]silylsilane |
| SMILES | C=CCCCC[Si](C)(C)OC.CO[SiH](C)C.O=[Si](O)[Si]([Si](=O)O)([Si](=O)O)[Si]([Si](=O)O)([Si](=O)O)[Si](=O)O |
| InChI | InChI=1S/C9H20OSi.C3H10OSi.H6O12Si8/c1-5-6-7-8-9-11(3,4)10-2;1-4-5(2)3;1-13(2)19(14(3)4,15(5)6)20(16(7)8,17(9)10)18(11)12/h5H,1,6-9H2,2-4H3;5H,1-3H3;1,3,5,7,9,11H |
| InChIKey | LQEWUMPRTAGJSA-UHFFFAOYSA-N |
| XLogP | -3.29 |
| TPSA | 242.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.27 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|