C32H46N4O4 — CID 123317276
2-cyclohexyl-N-[1-(3-formyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3,3-dimethyl-1-oxobutan-2-yl]-2-[2-(2-oxo-2-pyrazin-2-ylethyl)cyclobutyl]acetamide (PubChem CID 123317276) has the molecular formula C32H46N4O4 and a molecular weight of 550.74 g/mol. Its IUPAC name is 2-cyclohexyl-N-[1-(3-formyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3,3-dimethyl-1-oxobutan-2-yl]-2-[2-(2-oxo-2-pyrazin-2-ylethyl)cyclobutyl]acetamide.
| Compound Name | 2-cyclohexyl-N-[1-(3-formyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3,3-dimethyl-1-oxobutan-2-yl]-2-[2-(2-oxo-2-pyrazin-2-ylethyl)cyclobutyl]acetamide |
|---|---|
| PubChem CID | 123317276 |
| Molecular Formula | C32H46N4O4 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.35 |
| IUPAC Name | 2-cyclohexyl-N-[1-(3-formyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3,3-dimethyl-1-oxobutan-2-yl]-2-[2-(2-oxo-2-pyrazin-2-ylethyl)cyclobutyl]acetamide |
| SMILES | CC(C)(C)C(NC(=O)C(C1CCCCC1)C1CCC1CC(=O)c1cnccn1)C(=O)N1CC2CCCC2C1C=O |
| InChI | InChI=1S/C32H46N4O4/c1-32(2,3)29(31(40)36-18-22-10-7-11-23(22)26(36)19-37)35-30(39)28(20-8-5-4-6-9-20)24-13-12-21(24)16-27(38)25-17-33-14-15-34-25/h14-15,17,19-24,26,28-29H,4-13,16,18H2,1-3H3,(H,35,39) |
| InChIKey | TVBPJXPYUDPJLL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|