C22H37N3O3 — CID 89040025
(2S)-N-[(2S)-1-[(3S,3aS,6aR)-3-formyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-amino-2-cyclohexylacetamide (PubChem CID 89040025) has the molecular formula C22H37N3O3 and a molecular weight of 391.56 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[(3S,3aS,6aR)-3-formyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-amino-2-cyclohexylacetamide.
| Compound Name | (2S)-N-[(2S)-1-[(3S,3aS,6aR)-3-formyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-amino-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 89040025 |
| Molecular Formula | C22H37N3O3 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | (2S)-N-[(2S)-1-[(3S,3aS,6aR)-3-formyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-amino-2-cyclohexylacetamide |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@@H](N)C1CCCCC1)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C=O |
| InChI | InChI=1S/C22H37N3O3/c1-22(2,3)19(24-20(27)18(23)14-8-5-4-6-9-14)21(28)25-12-15-10-7-11-16(15)17(25)13-26/h13-19H,4-12,23H2,1-3H3,(H,24,27)/t15-,16-,17+,18-,19+/m0/s1 |
| InChIKey | LGYOYEAKUJSUAO-QXCZDIPSSA-N |
| XLogP | 2.25 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|