C22H39N3O2 — CID 58855739
(2S)-N-[1-[(3R,3aS,6aR)-3-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-amino-2-cyclohexylacetamide (PubChem CID 58855739) has the molecular formula C22H39N3O2 and a molecular weight of 377.57 g/mol. Its IUPAC name is (2S)-N-[1-[(3R,3aS,6aR)-3-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-amino-2-cyclohexylacetamide.
| Compound Name | (2S)-N-[1-[(3R,3aS,6aR)-3-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-amino-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 58855739 |
| Molecular Formula | C22H39N3O2 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.30 |
| IUPAC Name | (2S)-N-[1-[(3R,3aS,6aR)-3-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-amino-2-cyclohexylacetamide |
| SMILES | C[C@@H]1[C@H]2CCC[C@H]2CN1C(=O)C(NC(=O)[C@@H](N)C1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C22H39N3O2/c1-14-17-12-8-11-16(17)13-25(14)21(27)19(22(2,3)4)24-20(26)18(23)15-9-6-5-7-10-15/h14-19H,5-13,23H2,1-4H3,(H,24,26)/t14-,16+,17-,18+,19?/m1/s1 |
| InChIKey | SNWDWYBLCMOXLL-TUHMIAJYSA-N |
| XLogP | 3.07 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |